C23H28ClN3O5S — CID 24560547
ethyl 2-(4-chlorophenyl)-2-[4-[3-(ethylsulfamoyl)benzoyl]piperazin-1-yl]acetate (PubChem CID 24560547) has the molecular formula C23H28ClN3O5S and a molecular weight of 494.01 g/mol. Its IUPAC name is ethyl 2-(4-chlorophenyl)-2-[4-[3-(ethylsulfamoyl)benzoyl]piperazin-1-yl]acetate.
| Compound Name | ethyl 2-(4-chlorophenyl)-2-[4-[3-(ethylsulfamoyl)benzoyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 24560547 |
| Molecular Formula | C23H28ClN3O5S |
| Molecular Weight | 494.01 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | ethyl 2-(4-chlorophenyl)-2-[4-[3-(ethylsulfamoyl)benzoyl]piperazin-1-yl]acetate |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)N2CCN(C(C(=O)OCC)c3ccc(Cl)cc3)CC2)c1 |
| InChI | InChI=1S/C23H28ClN3O5S/c1-3-25-33(30,31)20-7-5-6-18(16-20)22(28)27-14-12-26(13-15-27)21(23(29)32-4-2)17-8-10-19(24)11-9-17/h5-11,16,21,25H,3-4,12-15H2,1-2H3 |
| InChIKey | OHUBZFKHUFYMQF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.01 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |