C14H18ClNO2 — CID 162420045
ethyl (2R)-2-(4-chlorophenyl)-2-pyrrolidin-1-ylacetate (PubChem CID 162420045) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is ethyl (2R)-2-(4-chlorophenyl)-2-pyrrolidin-1-ylacetate.
| Compound Name | ethyl (2R)-2-(4-chlorophenyl)-2-pyrrolidin-1-ylacetate |
|---|---|
| PubChem CID | 162420045 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | ethyl (2R)-2-(4-chlorophenyl)-2-pyrrolidin-1-ylacetate |
| SMILES | CCOC(=O)[C@@H](c1ccc(Cl)cc1)N1CCCC1 |
| InChI | InChI=1S/C14H18ClNO2/c1-2-18-14(17)13(16-9-3-4-10-16)11-5-7-12(15)8-6-11/h5-8,13H,2-4,9-10H2,1H3/t13-/m1/s1 |
| InChIKey | ICRZRHYSNYXPFZ-CYBMUJFWSA-N |
| XLogP | 3.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |