C15H21BrN2O2 — CID 60992975
ethyl 2-(4-bromophenyl)-2-(1,4-diazepan-1-yl)acetate (PubChem CID 60992975) has the molecular formula C15H21BrN2O2 and a molecular weight of 341.25 g/mol. Its IUPAC name is ethyl 2-(4-bromophenyl)-2-(1,4-diazepan-1-yl)acetate.
| Compound Name | ethyl 2-(4-bromophenyl)-2-(1,4-diazepan-1-yl)acetate |
|---|---|
| PubChem CID | 60992975 |
| Molecular Formula | C15H21BrN2O2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | ethyl 2-(4-bromophenyl)-2-(1,4-diazepan-1-yl)acetate |
| SMILES | CCOC(=O)C(c1ccc(Br)cc1)N1CCCNCC1 |
| InChI | InChI=1S/C15H21BrN2O2/c1-2-20-15(19)14(12-4-6-13(16)7-5-12)18-10-3-8-17-9-11-18/h4-7,14,17H,2-3,8-11H2,1H3 |
| InChIKey | FRKVUEHLQVYAMN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |