C15H20BrClN2O2 — CID 66158234
ethyl 2-(2-bromo-5-chlorophenyl)-2-(1,4-diazepan-1-yl)acetate (PubChem CID 66158234) has the molecular formula C15H20BrClN2O2 and a molecular weight of 375.69 g/mol. Its IUPAC name is ethyl 2-(2-bromo-5-chlorophenyl)-2-(1,4-diazepan-1-yl)acetate.
| Compound Name | ethyl 2-(2-bromo-5-chlorophenyl)-2-(1,4-diazepan-1-yl)acetate |
|---|---|
| PubChem CID | 66158234 |
| Molecular Formula | C15H20BrClN2O2 |
| Molecular Weight | 375.69 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | ethyl 2-(2-bromo-5-chlorophenyl)-2-(1,4-diazepan-1-yl)acetate |
| SMILES | CCOC(=O)C(c1cc(Cl)ccc1Br)N1CCCNCC1 |
| InChI | InChI=1S/C15H20BrClN2O2/c1-2-21-15(20)14(19-8-3-6-18-7-9-19)12-10-11(17)4-5-13(12)16/h4-5,10,14,18H,2-3,6-9H2,1H3 |
| InChIKey | ZCBJDBCRBMHGQY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.69 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |