C14H18BrClN2O2 — CID 66158233
methyl 2-(2-bromo-5-chlorophenyl)-2-(1,4-diazepan-1-yl)acetate (PubChem CID 66158233) has the molecular formula C14H18BrClN2O2 and a molecular weight of 361.67 g/mol. Its IUPAC name is methyl 2-(2-bromo-5-chlorophenyl)-2-(1,4-diazepan-1-yl)acetate.
| Compound Name | methyl 2-(2-bromo-5-chlorophenyl)-2-(1,4-diazepan-1-yl)acetate |
|---|---|
| PubChem CID | 66158233 |
| Molecular Formula | C14H18BrClN2O2 |
| Molecular Weight | 361.67 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | methyl 2-(2-bromo-5-chlorophenyl)-2-(1,4-diazepan-1-yl)acetate |
| SMILES | COC(=O)C(c1cc(Cl)ccc1Br)N1CCCNCC1 |
| InChI | InChI=1S/C14H18BrClN2O2/c1-20-14(19)13(18-7-2-5-17-6-8-18)11-9-10(16)3-4-12(11)15/h3-4,9,13,17H,2,5-8H2,1H3 |
| InChIKey | GXJQQMORSNMRJR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.67 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |