C13H16ClFN2O2 — CID 114453677
methyl 2-(3-chloro-5-fluorophenyl)-2-piperazin-1-ylacetate (PubChem CID 114453677) has the molecular formula C13H16ClFN2O2 and a molecular weight of 286.73 g/mol. Its IUPAC name is methyl 2-(3-chloro-5-fluorophenyl)-2-piperazin-1-ylacetate.
| Compound Name | methyl 2-(3-chloro-5-fluorophenyl)-2-piperazin-1-ylacetate |
|---|---|
| PubChem CID | 114453677 |
| Molecular Formula | C13H16ClFN2O2 |
| Molecular Weight | 286.73 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | methyl 2-(3-chloro-5-fluorophenyl)-2-piperazin-1-ylacetate |
| SMILES | COC(=O)C(c1cc(F)cc(Cl)c1)N1CCNCC1 |
| InChI | InChI=1S/C13H16ClFN2O2/c1-19-13(18)12(17-4-2-16-3-5-17)9-6-10(14)8-11(15)7-9/h6-8,12,16H,2-5H2,1H3 |
| InChIKey | PBSAWEZNINUJIB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.73 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |