C19H28ClN3O2 — CID 120850183
methyl 2-(3-chlorophenyl)-2-[4-(piperidin-4-ylmethyl)piperazin-1-yl]acetate (PubChem CID 120850183) has the molecular formula C19H28ClN3O2 and a molecular weight of 365.91 g/mol. Its IUPAC name is methyl 2-(3-chlorophenyl)-2-[4-(piperidin-4-ylmethyl)piperazin-1-yl]acetate.
| Compound Name | methyl 2-(3-chlorophenyl)-2-[4-(piperidin-4-ylmethyl)piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 120850183 |
| Molecular Formula | C19H28ClN3O2 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | methyl 2-(3-chlorophenyl)-2-[4-(piperidin-4-ylmethyl)piperazin-1-yl]acetate |
| SMILES | COC(=O)C(c1cccc(Cl)c1)N1CCN(CC2CCNCC2)CC1 |
| InChI | InChI=1S/C19H28ClN3O2/c1-25-19(24)18(16-3-2-4-17(20)13-16)23-11-9-22(10-12-23)14-15-5-7-21-8-6-15/h2-4,13,15,18,21H,5-12,14H2,1H3 |
| InChIKey | BJJPOIPWWOYJSE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |