C18H27N3O2 — CID 119930350
(3-methoxyphenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone (PubChem CID 119930350) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is (3-methoxyphenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (3-methoxyphenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 119930350 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | (3-methoxyphenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone |
| SMILES | COc1cccc(C(=O)N2CCN(CC3CCNCC3)CC2)c1 |
| InChI | InChI=1S/C18H27N3O2/c1-23-17-4-2-3-16(13-17)18(22)21-11-9-20(10-12-21)14-15-5-7-19-8-6-15/h2-4,13,15,19H,5-12,14H2,1H3 |
| InChIKey | TUHAUNOTKGDAJQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |