C20H26N2O2 — CID 7354682
[4-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazin-1-yl]-(3-methoxyphenyl)methanone (PubChem CID 7354682) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is [4-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazin-1-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [4-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazin-1-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 7354682 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | [4-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazin-1-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2CCN(C[C@@H]3C[C@@H]4C=C[C@@H]3C4)CC2)c1 |
| InChI | InChI=1S/C20H26N2O2/c1-24-19-4-2-3-17(13-19)20(23)22-9-7-21(8-10-22)14-18-12-15-5-6-16(18)11-15/h2-6,13,15-16,18H,7-12,14H2,1H3/t15-,16-,18+/m1/s1 |
| InChIKey | HVAVOXHNZSHXEB-NUJGCVRESA-N |
| XLogP | 2.67 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|