C19H23FN2O — CID 98194660
[4-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazin-1-yl]-(4-fluorophenyl)methanone (PubChem CID 98194660) has the molecular formula C19H23FN2O and a molecular weight of 314.40 g/mol. Its IUPAC name is [4-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazin-1-yl]-(4-fluorophenyl)methanone.
| Compound Name | [4-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazin-1-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 98194660 |
| Molecular Formula | C19H23FN2O |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | [4-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazin-1-yl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCN(C[C@H]2C[C@H]3C=C[C@H]2C3)CC1 |
| InChI | InChI=1S/C19H23FN2O/c20-18-5-3-15(4-6-18)19(23)22-9-7-21(8-10-22)13-17-12-14-1-2-16(17)11-14/h1-6,14,16-17H,7-13H2/t14-,16-,17+/m0/s1 |
| InChIKey | CUXKGUCXKYQWSO-BHYGNILZSA-N |
| XLogP | 2.80 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|