C21H29N2O3+ — CID 11861969
[4-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazin-4-ium-1-yl]-(3,5-dimethoxyphenyl)methanone (PubChem CID 11861969) has the molecular formula C21H29N2O3+ and a molecular weight of 357.47 g/mol. Its IUPAC name is [4-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazin-4-ium-1-yl]-(3,5-dimethoxyphenyl)methanone.
| Compound Name | [4-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazin-4-ium-1-yl]-(3,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 11861969 |
| Molecular Formula | C21H29N2O3+ |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | [4-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazin-4-ium-1-yl]-(3,5-dimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)cc(C(=O)N2CC[NH+](C[C@H]3C[C@@H]4C=C[C@H]3C4)CC2)c1 |
| InChI | InChI=1S/C21H28N2O3/c1-25-19-11-17(12-20(13-19)26-2)21(24)23-7-5-22(6-8-23)14-18-10-15-3-4-16(18)9-15/h3-4,11-13,15-16,18H,5-10,14H2,1-2H3/p+1/t15-,16+,18-/m1/s1 |
| InChIKey | ZDCVRJCVAWTNFG-SOLBZPMBSA-O |
| XLogP | 1.26 |
| TPSA | 43.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|