C19H27N2O3S+ — CID 18389749
1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(4-methoxyphenyl)sulfonylpiperazin-1-ium (PubChem CID 18389749) has the molecular formula C19H27N2O3S+ and a molecular weight of 363.50 g/mol. Its IUPAC name is 1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(4-methoxyphenyl)sulfonylpiperazin-1-ium.
| Compound Name | 1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(4-methoxyphenyl)sulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 18389749 |
| Molecular Formula | C19H27N2O3S+ |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(4-methoxyphenyl)sulfonylpiperazin-1-ium |
| SMILES | COc1ccc(S(=O)(=O)N2CC[NH+](C[C@H]3C[C@H]4C=C[C@H]3C4)CC2)cc1 |
| InChI | InChI=1S/C19H26N2O3S/c1-24-18-4-6-19(7-5-18)25(22,23)21-10-8-20(9-11-21)14-17-13-15-2-3-16(17)12-15/h2-7,15-17H,8-14H2,1H3/p+1/t15-,16-,17+/m0/s1 |
| InChIKey | GOQKTRCRRQDRHQ-YESZJQIVSA-O |
| XLogP | 0.80 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|