C20H25N2O3S+ — CID 4751871
1-(4-methoxyphenyl)sulfonyl-4-(3-phenylprop-2-enyl)piperazin-4-ium (PubChem CID 4751871) has the molecular formula C20H25N2O3S+ and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)sulfonyl-4-(3-phenylprop-2-enyl)piperazin-4-ium.
| Compound Name | 1-(4-methoxyphenyl)sulfonyl-4-(3-phenylprop-2-enyl)piperazin-4-ium |
|---|---|
| PubChem CID | 4751871 |
| Molecular Formula | C20H25N2O3S+ |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 1-(4-methoxyphenyl)sulfonyl-4-(3-phenylprop-2-enyl)piperazin-4-ium |
| SMILES | COc1ccc(S(=O)(=O)N2CC[NH+](CC=Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C20H24N2O3S/c1-25-19-9-11-20(12-10-19)26(23,24)22-16-14-21(15-17-22)13-5-8-18-6-3-2-4-7-18/h2-12H,13-17H2,1H3/p+1 |
| InChIKey | SEUCUYPQXKDFFJ-UHFFFAOYSA-O |
| XLogP | 1.30 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |