C20H27N2O4S+ — CID 4756058
1-[(2-ethoxyphenyl)methyl]-4-(4-methoxyphenyl)sulfonylpiperazin-1-ium (PubChem CID 4756058) has the molecular formula C20H27N2O4S+ and a molecular weight of 391.51 g/mol. Its IUPAC name is 1-[(2-ethoxyphenyl)methyl]-4-(4-methoxyphenyl)sulfonylpiperazin-1-ium.
| Compound Name | 1-[(2-ethoxyphenyl)methyl]-4-(4-methoxyphenyl)sulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 4756058 |
| Molecular Formula | C20H27N2O4S+ |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 1-[(2-ethoxyphenyl)methyl]-4-(4-methoxyphenyl)sulfonylpiperazin-1-ium |
| SMILES | CCOc1ccccc1C[NH+]1CCN(S(=O)(=O)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C20H26N2O4S/c1-3-26-20-7-5-4-6-17(20)16-21-12-14-22(15-13-21)27(23,24)19-10-8-18(25-2)9-11-19/h4-11H,3,12-16H2,1-2H3/p+1 |
| InChIKey | RACQOGTYCOGULC-UHFFFAOYSA-O |
| XLogP | 1.18 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |