C20H25N2O5S+ — CID 4663163
1-(1,3-benzodioxol-5-ylmethyl)-4-(4-ethoxyphenyl)sulfonylpiperazin-1-ium (PubChem CID 4663163) has the molecular formula C20H25N2O5S+ and a molecular weight of 405.50 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-4-(4-ethoxyphenyl)sulfonylpiperazin-1-ium.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-(4-ethoxyphenyl)sulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 4663163 |
| Molecular Formula | C20H25N2O5S+ |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-(4-ethoxyphenyl)sulfonylpiperazin-1-ium |
| SMILES | CCOc1ccc(S(=O)(=O)N2CC[NH+](Cc3ccc4c(c3)OCO4)CC2)cc1 |
| InChI | InChI=1S/C20H24N2O5S/c1-2-25-17-4-6-18(7-5-17)28(23,24)22-11-9-21(10-12-22)14-16-3-8-19-20(13-16)27-15-26-19/h3-8,13H,2,9-12,14-15H2,1H3/p+1 |
| InChIKey | PJXFITMKOXRQSH-UHFFFAOYSA-O |
| XLogP | 0.90 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |