C15H23N2O4S+ — CID 4742029
1-(1,3-benzodioxol-5-ylmethyl)-4-propylsulfonylpiperazin-1-ium (PubChem CID 4742029) has the molecular formula C15H23N2O4S+ and a molecular weight of 327.43 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-4-propylsulfonylpiperazin-1-ium.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-propylsulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 4742029 |
| Molecular Formula | C15H23N2O4S+ |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-propylsulfonylpiperazin-1-ium |
| SMILES | CCCS(=O)(=O)N1CC[NH+](Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C15H22N2O4S/c1-2-9-22(18,19)17-7-5-16(6-8-17)11-13-3-4-14-15(10-13)21-12-20-14/h3-4,10H,2,5-9,11-12H2,1H3/p+1 |
| InChIKey | RDYFTHBVAMMQQS-UHFFFAOYSA-O |
| XLogP | -0.14 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |