C18H21N2O4S+ — CID 3439858
1-(benzenesulfonyl)-4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium (PubChem CID 3439858) has the molecular formula C18H21N2O4S+ and a molecular weight of 361.44 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium.
| Compound Name | 1-(benzenesulfonyl)-4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium |
|---|---|
| PubChem CID | 3439858 |
| Molecular Formula | C18H21N2O4S+ |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 1-(benzenesulfonyl)-4-(1,3-benzodioxol-5-ylmethyl)piperazin-4-ium |
| SMILES | O=S(=O)(c1ccccc1)N1CC[NH+](Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C18H20N2O4S/c21-25(22,16-4-2-1-3-5-16)20-10-8-19(9-11-20)13-15-6-7-17-18(12-15)24-14-23-17/h1-7,12H,8-11,13-14H2/p+1 |
| InChIKey | OEMVHNGCXFDGTI-UHFFFAOYSA-O |
| XLogP | 0.50 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |