C18H19Cl2N2O4S+ — CID 4105213
1-(1,3-benzodioxol-5-ylmethyl)-4-(2,6-dichlorophenyl)sulfonylpiperazin-1-ium (PubChem CID 4105213) has the molecular formula C18H19Cl2N2O4S+ and a molecular weight of 430.33 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-4-(2,6-dichlorophenyl)sulfonylpiperazin-1-ium.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-(2,6-dichlorophenyl)sulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 4105213 |
| Molecular Formula | C18H19Cl2N2O4S+ |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-(2,6-dichlorophenyl)sulfonylpiperazin-1-ium |
| SMILES | O=S(=O)(c1c(Cl)cccc1Cl)N1CC[NH+](Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C18H18Cl2N2O4S/c19-14-2-1-3-15(20)18(14)27(23,24)22-8-6-21(7-9-22)11-13-4-5-16-17(10-13)26-12-25-16/h1-5,10H,6-9,11-12H2/p+1 |
| InChIKey | BOMKMRUKEWUAQU-UHFFFAOYSA-O |
| XLogP | 1.81 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |