C18H20FN2O2+ — CID 6944085
1-(1,3-benzodioxol-5-ylmethyl)-4-(2-fluorophenyl)piperazin-1-ium (PubChem CID 6944085) has the molecular formula C18H20FN2O2+ and a molecular weight of 315.37 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-4-(2-fluorophenyl)piperazin-1-ium.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-(2-fluorophenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 6944085 |
| Molecular Formula | C18H20FN2O2+ |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-(2-fluorophenyl)piperazin-1-ium |
| SMILES | Fc1ccccc1N1CC[NH+](Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C18H19FN2O2/c19-15-3-1-2-4-16(15)21-9-7-20(8-10-21)12-14-5-6-17-18(11-14)23-13-22-17/h1-6,11H,7-10,12-13H2/p+1 |
| InChIKey | VNNYASBHZWEYAF-UHFFFAOYSA-O |
| XLogP | 1.46 |
| TPSA | 26.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |