C18H19FN3O4+ — CID 6962469
1-(2-fluorophenyl)-4-[(6-nitro-1,3-benzodioxol-5-yl)methyl]piperazin-4-ium (PubChem CID 6962469) has the molecular formula C18H19FN3O4+ and a molecular weight of 360.37 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-4-[(6-nitro-1,3-benzodioxol-5-yl)methyl]piperazin-4-ium.
| Compound Name | 1-(2-fluorophenyl)-4-[(6-nitro-1,3-benzodioxol-5-yl)methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 6962469 |
| Molecular Formula | C18H19FN3O4+ |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 1-(2-fluorophenyl)-4-[(6-nitro-1,3-benzodioxol-5-yl)methyl]piperazin-4-ium |
| SMILES | O=[N+]([O-])c1cc2c(cc1C[NH+]1CCN(c3ccccc3F)CC1)OCO2 |
| InChI | InChI=1S/C18H18FN3O4/c19-14-3-1-2-4-15(14)21-7-5-20(6-8-21)11-13-9-17-18(26-12-25-17)10-16(13)22(23)24/h1-4,9-10H,5-8,11-12H2/p+1 |
| InChIKey | NWLSYTXOZRHQNV-UHFFFAOYSA-O |
| XLogP | 1.37 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|