C19H18FN2O4+ — CID 7443865
4-(4-fluorophenyl)-1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1,2,3,6-tetrahydropyridin-1-ium (PubChem CID 7443865) has the molecular formula C19H18FN2O4+ and a molecular weight of 357.36 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1,2,3,6-tetrahydropyridin-1-ium.
| Compound Name | 4-(4-fluorophenyl)-1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1,2,3,6-tetrahydropyridin-1-ium |
|---|---|
| PubChem CID | 7443865 |
| Molecular Formula | C19H18FN2O4+ |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 4-(4-fluorophenyl)-1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1,2,3,6-tetrahydropyridin-1-ium |
| SMILES | O=[N+]([O-])c1cc2c(cc1C[NH+]1CC=C(c3ccc(F)cc3)CC1)OCO2 |
| InChI | InChI=1S/C19H17FN2O4/c20-16-3-1-13(2-4-16)14-5-7-21(8-6-14)11-15-9-18-19(26-12-25-18)10-17(15)22(23)24/h1-5,9-10H,6-8,11-12H2/p+1 |
| InChIKey | DBDIRBJGUQJDQF-UHFFFAOYSA-O |
| XLogP | 2.33 |
| TPSA | 66.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|