C10H10F2N2O4 — CID 171313772
(1R)-3,3-difluoro-1-(6-nitro-1,3-benzodioxol-5-yl)propan-1-amine (PubChem CID 171313772) has the molecular formula C10H10F2N2O4 and a molecular weight of 260.20 g/mol. Its IUPAC name is (1R)-3,3-difluoro-1-(6-nitro-1,3-benzodioxol-5-yl)propan-1-amine.
| Compound Name | (1R)-3,3-difluoro-1-(6-nitro-1,3-benzodioxol-5-yl)propan-1-amine |
|---|---|
| PubChem CID | 171313772 |
| Molecular Formula | C10H10F2N2O4 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | (1R)-3,3-difluoro-1-(6-nitro-1,3-benzodioxol-5-yl)propan-1-amine |
| SMILES | N[C@H](CC(F)F)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C10H10F2N2O4/c11-10(12)2-6(13)5-1-8-9(18-4-17-8)3-7(5)14(15)16/h1,3,6,10H,2,4,13H2/t6-/m1/s1 |
| InChIKey | ZDTDAGIEYWZLKJ-ZCFIWIBFSA-N |
| XLogP | 1.98 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|