C11H15ClN2O5 — CID 171263579
(1R,2S)-1-amino-1-(6-nitro-1,3-benzodioxol-5-yl)butan-2-ol;hydrochloride (PubChem CID 171263579) has the molecular formula C11H15ClN2O5 and a molecular weight of 290.70 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(6-nitro-1,3-benzodioxol-5-yl)butan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-(6-nitro-1,3-benzodioxol-5-yl)butan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171263579 |
| Molecular Formula | C11H15ClN2O5 |
| Molecular Weight | 290.70 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | (1R,2S)-1-amino-1-(6-nitro-1,3-benzodioxol-5-yl)butan-2-ol;hydrochloride |
| SMILES | CC[C@H](O)[C@H](N)c1cc2c(cc1[N+](=O)[O-])OCO2.Cl |
| InChI | InChI=1S/C11H14N2O5.ClH/c1-2-8(14)11(12)6-3-9-10(18-5-17-9)4-7(6)13(15)16;/h3-4,8,11,14H,2,5,12H2,1H3;1H/t8-,11+;/m0./s1 |
| InChIKey | NFPCMCMGOQBFKY-IBYXRORRSA-N |
| XLogP | 1.52 |
| TPSA | 107.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.70 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|