C13H18N2O5 — CID 171263598
(1R,2S)-1-amino-1-(6-nitro-1,3-benzodioxol-5-yl)hexan-2-ol (PubChem CID 171263598) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(6-nitro-1,3-benzodioxol-5-yl)hexan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-(6-nitro-1,3-benzodioxol-5-yl)hexan-2-ol |
|---|---|
| PubChem CID | 171263598 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (1R,2S)-1-amino-1-(6-nitro-1,3-benzodioxol-5-yl)hexan-2-ol |
| SMILES | CCCC[C@H](O)[C@H](N)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C13H18N2O5/c1-2-3-4-10(16)13(14)8-5-11-12(20-7-19-11)6-9(8)15(17)18/h5-6,10,13,16H,2-4,7,14H2,1H3/t10-,13+/m0/s1 |
| InChIKey | AHDHFGPHIRAJLK-GXFFZTMASA-N |
| XLogP | 1.87 |
| TPSA | 107.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|