C12H14ClFN2O6 — CID 171242480
ethyl (3R)-3-amino-2-fluoro-3-(6-nitro-1,3-benzodioxol-5-yl)propanoate;hydrochloride (PubChem CID 171242480) has the molecular formula C12H14ClFN2O6 and a molecular weight of 336.70 g/mol. Its IUPAC name is ethyl (3R)-3-amino-2-fluoro-3-(6-nitro-1,3-benzodioxol-5-yl)propanoate;hydrochloride.
| Compound Name | ethyl (3R)-3-amino-2-fluoro-3-(6-nitro-1,3-benzodioxol-5-yl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171242480 |
| Molecular Formula | C12H14ClFN2O6 |
| Molecular Weight | 336.70 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | ethyl (3R)-3-amino-2-fluoro-3-(6-nitro-1,3-benzodioxol-5-yl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@H](N)c1cc2c(cc1[N+](=O)[O-])OCO2.Cl |
| InChI | InChI=1S/C12H13FN2O6.ClH/c1-2-19-12(16)10(13)11(14)6-3-8-9(21-5-20-8)4-7(6)15(17)18;/h3-4,10-11H,2,5,14H2,1H3;1H/t10?,11-;/m1./s1 |
| InChIKey | QVVUKVHJJWBTEZ-PSDUUTOMSA-N |
| XLogP | 1.65 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.70 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|