C12H13NO8 — CID 6709930
ethyl (2R,3S)-2,3-dihydroxy-3-(6-nitro-1,3-benzodioxol-5-yl)propanoate (PubChem CID 6709930) has the molecular formula C12H13NO8 and a molecular weight of 299.24 g/mol. Its IUPAC name is ethyl (2R,3S)-2,3-dihydroxy-3-(6-nitro-1,3-benzodioxol-5-yl)propanoate.
| Compound Name | ethyl (2R,3S)-2,3-dihydroxy-3-(6-nitro-1,3-benzodioxol-5-yl)propanoate |
|---|---|
| PubChem CID | 6709930 |
| Molecular Formula | C12H13NO8 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | ethyl (2R,3S)-2,3-dihydroxy-3-(6-nitro-1,3-benzodioxol-5-yl)propanoate |
| SMILES | CCOC(=O)[C@H](O)[C@@H](O)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C12H13NO8/c1-2-19-12(16)11(15)10(14)6-3-8-9(21-5-20-8)4-7(6)13(17)18/h3-4,10-11,14-15H,2,5H2,1H3/t10-,11+/m0/s1 |
| InChIKey | QMZIGEJQFSOEKH-WDEREUQCSA-N |
| XLogP | 0.28 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|