C10H12ClN3O6 — CID 171866820
ethyl 3-(6-amino-2-chloro-5-nitro-3-pyridinyl)-2,3-dihydroxypropanoate (PubChem CID 171866820) has the molecular formula C10H12ClN3O6 and a molecular weight of 305.67 g/mol. Its IUPAC name is ethyl 3-(6-amino-2-chloro-5-nitro-3-pyridinyl)-2,3-dihydroxypropanoate.
| Compound Name | ethyl 3-(6-amino-2-chloro-5-nitro-3-pyridinyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171866820 |
| Molecular Formula | C10H12ClN3O6 |
| Molecular Weight | 305.67 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | ethyl 3-(6-amino-2-chloro-5-nitro-3-pyridinyl)-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)C(O)c1cc([N+](=O)[O-])c(N)nc1Cl |
| InChI | InChI=1S/C10H12ClN3O6/c1-2-20-10(17)7(16)6(15)4-3-5(14(18)19)9(12)13-8(4)11/h3,6-7,15-16H,2H2,1H3,(H2,12,13) |
| InChIKey | NRUFGKLZLCJCGW-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 148.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.67 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|