C10H12ClN3O5 — CID 171899800
4-(6-chloro-2-methyl-5-nitro-3-pyridinyl)-3,4-dihydroxybutanamide (PubChem CID 171899800) has the molecular formula C10H12ClN3O5 and a molecular weight of 289.68 g/mol. Its IUPAC name is 4-(6-chloro-2-methyl-5-nitro-3-pyridinyl)-3,4-dihydroxybutanamide.
| Compound Name | 4-(6-chloro-2-methyl-5-nitro-3-pyridinyl)-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171899800 |
| Molecular Formula | C10H12ClN3O5 |
| Molecular Weight | 289.68 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 4-(6-chloro-2-methyl-5-nitro-3-pyridinyl)-3,4-dihydroxybutanamide |
| SMILES | Cc1nc(Cl)c([N+](=O)[O-])cc1C(O)C(O)CC(N)=O |
| InChI | InChI=1S/C10H12ClN3O5/c1-4-5(9(17)7(15)3-8(12)16)2-6(14(18)19)10(11)13-4/h2,7,9,15,17H,3H2,1H3,(H2,12,16) |
| InChIKey | PYHGQKMUDKEAKC-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 139.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.68 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|