C10H13ClN2O4S — CID 171874718
1-(6-chloro-2-methyl-5-nitro-3-pyridinyl)-4-sulfanylbutane-1,2-diol (PubChem CID 171874718) has the molecular formula C10H13ClN2O4S and a molecular weight of 292.74 g/mol. Its IUPAC name is 1-(6-chloro-2-methyl-5-nitro-3-pyridinyl)-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-(6-chloro-2-methyl-5-nitro-3-pyridinyl)-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171874718 |
| Molecular Formula | C10H13ClN2O4S |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 1-(6-chloro-2-methyl-5-nitro-3-pyridinyl)-4-sulfanylbutane-1,2-diol |
| SMILES | Cc1nc(Cl)c([N+](=O)[O-])cc1C(O)C(O)CCS |
| InChI | InChI=1S/C10H13ClN2O4S/c1-5-6(9(15)8(14)2-3-18)4-7(13(16)17)10(11)12-5/h4,8-9,14-15,18H,2-3H2,1H3 |
| InChIKey | SDTZMUIBEGJAKK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|