C8H12ClN3O2S — CID 171873895
1-(2-amino-4-chloropyrimidin-5-yl)-4-sulfanylbutane-1,2-diol (PubChem CID 171873895) has the molecular formula C8H12ClN3O2S and a molecular weight of 249.72 g/mol. Its IUPAC name is 1-(2-amino-4-chloropyrimidin-5-yl)-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-(2-amino-4-chloropyrimidin-5-yl)-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171873895 |
| Molecular Formula | C8H12ClN3O2S |
| Molecular Weight | 249.72 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 1-(2-amino-4-chloropyrimidin-5-yl)-4-sulfanylbutane-1,2-diol |
| SMILES | Nc1ncc(C(O)C(O)CCS)c(Cl)n1 |
| InChI | InChI=1S/C8H12ClN3O2S/c9-7-4(3-11-8(10)12-7)6(14)5(13)1-2-15/h3,5-6,13-15H,1-2H2,(H2,10,11,12) |
| InChIKey | QKHUOUXOMZOLND-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.72 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|