C10H14ClNO2S — CID 171873792
1-(2-amino-5-chlorophenyl)-4-sulfanylbutane-1,2-diol (PubChem CID 171873792) has the molecular formula C10H14ClNO2S and a molecular weight of 247.75 g/mol. Its IUPAC name is 1-(2-amino-5-chlorophenyl)-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-(2-amino-5-chlorophenyl)-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171873792 |
| Molecular Formula | C10H14ClNO2S |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 1-(2-amino-5-chlorophenyl)-4-sulfanylbutane-1,2-diol |
| SMILES | Nc1ccc(Cl)cc1C(O)C(O)CCS |
| InChI | InChI=1S/C10H14ClNO2S/c11-6-1-2-8(12)7(5-6)10(14)9(13)3-4-15/h1-2,5,9-10,13-15H,3-4,12H2 |
| InChIKey | OITBKWGROLTENY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|