C10H13F2NO2S — CID 171874160
1-(2-amino-4,5-difluorophenyl)-4-sulfanylbutane-1,2-diol (PubChem CID 171874160) has the molecular formula C10H13F2NO2S and a molecular weight of 249.28 g/mol. Its IUPAC name is 1-(2-amino-4,5-difluorophenyl)-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-(2-amino-4,5-difluorophenyl)-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171874160 |
| Molecular Formula | C10H13F2NO2S |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 1-(2-amino-4,5-difluorophenyl)-4-sulfanylbutane-1,2-diol |
| SMILES | Nc1cc(F)c(F)cc1C(O)C(O)CCS |
| InChI | InChI=1S/C10H13F2NO2S/c11-6-3-5(8(13)4-7(6)12)10(15)9(14)1-2-16/h3-4,9-10,14-16H,1-2,13H2 |
| InChIKey | ZLFLOMRBICSEMJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|