C10H14F2N2O2 — CID 171881337
4-amino-1-(4-amino-2,5-difluorophenyl)butane-1,2-diol (PubChem CID 171881337) has the molecular formula C10H14F2N2O2 and a molecular weight of 232.23 g/mol. Its IUPAC name is 4-amino-1-(4-amino-2,5-difluorophenyl)butane-1,2-diol.
| Compound Name | 4-amino-1-(4-amino-2,5-difluorophenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171881337 |
| Molecular Formula | C10H14F2N2O2 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 4-amino-1-(4-amino-2,5-difluorophenyl)butane-1,2-diol |
| SMILES | NCCC(O)C(O)c1cc(F)c(N)cc1F |
| InChI | InChI=1S/C10H14F2N2O2/c11-6-4-8(14)7(12)3-5(6)10(16)9(15)1-2-13/h3-4,9-10,15-16H,1-2,13-14H2 |
| InChIKey | SVIAFTMDEAKCKQ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|