C12H16F4N2O2 — CID 171891129
1-[4-amino-5-fluoro-2-(trifluoromethyl)phenyl]-4-(methylamino)butane-1,2-diol (PubChem CID 171891129) has the molecular formula C12H16F4N2O2 and a molecular weight of 296.26 g/mol. Its IUPAC name is 1-[4-amino-5-fluoro-2-(trifluoromethyl)phenyl]-4-(methylamino)butane-1,2-diol.
| Compound Name | 1-[4-amino-5-fluoro-2-(trifluoromethyl)phenyl]-4-(methylamino)butane-1,2-diol |
|---|---|
| PubChem CID | 171891129 |
| Molecular Formula | C12H16F4N2O2 |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 1-[4-amino-5-fluoro-2-(trifluoromethyl)phenyl]-4-(methylamino)butane-1,2-diol |
| SMILES | CNCCC(O)C(O)c1cc(F)c(N)cc1C(F)(F)F |
| InChI | InChI=1S/C12H16F4N2O2/c1-18-3-2-10(19)11(20)6-4-8(13)9(17)5-7(6)12(14,15)16/h4-5,10-11,18-20H,2-3,17H2,1H3 |
| InChIKey | KOPRQCHVNFWZLR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|