C11H16F2N2O2 — CID 171890299
1-(4-amino-2,3-difluorophenyl)-4-(methylamino)butane-1,2-diol (PubChem CID 171890299) has the molecular formula C11H16F2N2O2 and a molecular weight of 246.26 g/mol. Its IUPAC name is 1-(4-amino-2,3-difluorophenyl)-4-(methylamino)butane-1,2-diol.
| Compound Name | 1-(4-amino-2,3-difluorophenyl)-4-(methylamino)butane-1,2-diol |
|---|---|
| PubChem CID | 171890299 |
| Molecular Formula | C11H16F2N2O2 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1-(4-amino-2,3-difluorophenyl)-4-(methylamino)butane-1,2-diol |
| SMILES | CNCCC(O)C(O)c1ccc(N)c(F)c1F |
| InChI | InChI=1S/C11H16F2N2O2/c1-15-5-4-8(16)11(17)6-2-3-7(14)10(13)9(6)12/h2-3,8,11,15-17H,4-5,14H2,1H3 |
| InChIKey | IEMWZUFQCXUCGK-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|