C10H16FN3O2 — CID 171889865
1-(3-amino-6-fluoro-2-pyridinyl)-4-(methylamino)butane-1,2-diol (PubChem CID 171889865) has the molecular formula C10H16FN3O2 and a molecular weight of 229.25 g/mol. Its IUPAC name is 1-(3-amino-6-fluoro-2-pyridinyl)-4-(methylamino)butane-1,2-diol.
| Compound Name | 1-(3-amino-6-fluoro-2-pyridinyl)-4-(methylamino)butane-1,2-diol |
|---|---|
| PubChem CID | 171889865 |
| Molecular Formula | C10H16FN3O2 |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 1-(3-amino-6-fluoro-2-pyridinyl)-4-(methylamino)butane-1,2-diol |
| SMILES | CNCCC(O)C(O)c1nc(F)ccc1N |
| InChI | InChI=1S/C10H16FN3O2/c1-13-5-4-7(15)10(16)9-6(12)2-3-8(11)14-9/h2-3,7,10,13,15-16H,4-5,12H2,1H3 |
| InChIKey | PFRMELGRJHVCBI-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|