C14H18N2O2 — CID 171890434
1-isoquinolin-1-yl-4-(methylamino)butane-1,2-diol (PubChem CID 171890434) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-isoquinolin-1-yl-4-(methylamino)butane-1,2-diol.
| Compound Name | 1-isoquinolin-1-yl-4-(methylamino)butane-1,2-diol |
|---|---|
| PubChem CID | 171890434 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1-isoquinolin-1-yl-4-(methylamino)butane-1,2-diol |
| SMILES | CNCCC(O)C(O)c1nccc2ccccc12 |
| InChI | InChI=1S/C14H18N2O2/c1-15-8-7-12(17)14(18)13-11-5-3-2-4-10(11)6-9-16-13/h2-6,9,12,14-15,17-18H,7-8H2,1H3 |
| InChIKey | JGXAWRSTBAMJKE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |