C20H16N2O2 — CID 125479415
(1R,2R)-1,2-di(isoquinolin-1-yl)ethane-1,2-diol (PubChem CID 125479415) has the molecular formula C20H16N2O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is (1R,2R)-1,2-di(isoquinolin-1-yl)ethane-1,2-diol.
| Compound Name | (1R,2R)-1,2-di(isoquinolin-1-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 125479415 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (1R,2R)-1,2-di(isoquinolin-1-yl)ethane-1,2-diol |
| SMILES | O[C@H](c1nccc2ccccc12)[C@H](O)c1nccc2ccccc12 |
| InChI | InChI=1S/C20H16N2O2/c23-19(17-15-7-3-1-5-13(15)9-11-21-17)20(24)18-16-8-4-2-6-14(16)10-12-22-18/h1-12,19-20,23-24H/t19-,20-/m1/s1 |
| InChIKey | LPPACGZHIOFSNW-WOJBJXKFSA-N |
| XLogP | 3.55 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |