C14H12N2OS — CID 112642535
1-isoquinolin-1-yl-2-(1,3-thiazol-5-yl)ethanol (PubChem CID 112642535) has the molecular formula C14H12N2OS and a molecular weight of 256.33 g/mol. Its IUPAC name is 1-isoquinolin-1-yl-2-(1,3-thiazol-5-yl)ethanol.
| Compound Name | 1-isoquinolin-1-yl-2-(1,3-thiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 112642535 |
| Molecular Formula | C14H12N2OS |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 1-isoquinolin-1-yl-2-(1,3-thiazol-5-yl)ethanol |
| SMILES | OC(Cc1cncs1)c1nccc2ccccc12 |
| InChI | InChI=1S/C14H12N2OS/c17-13(7-11-8-15-9-18-11)14-12-4-2-1-3-10(12)5-6-16-14/h1-6,8-9,13,17H,7H2 |
| InChIKey | MHCHOEYQQFGIME-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |