C11H10FNOS — CID 112641866
1-(2-fluorophenyl)-2-(1,3-thiazol-5-yl)ethanol (PubChem CID 112641866) has the molecular formula C11H10FNOS and a molecular weight of 223.27 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-2-(1,3-thiazol-5-yl)ethanol.
| Compound Name | 1-(2-fluorophenyl)-2-(1,3-thiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 112641866 |
| Molecular Formula | C11H10FNOS |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 1-(2-fluorophenyl)-2-(1,3-thiazol-5-yl)ethanol |
| SMILES | OC(Cc1cncs1)c1ccccc1F |
| InChI | InChI=1S/C11H10FNOS/c12-10-4-2-1-3-9(10)11(14)5-8-6-13-7-15-8/h1-4,6-7,11,14H,5H2 |
| InChIKey | STAWNDZBCNAPRL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |