C9H8FNOS2 — CID 130594756
1-(3-fluorothiophen-2-yl)-2-(1,3-thiazol-5-yl)ethanol (PubChem CID 130594756) has the molecular formula C9H8FNOS2 and a molecular weight of 229.30 g/mol. Its IUPAC name is 1-(3-fluorothiophen-2-yl)-2-(1,3-thiazol-5-yl)ethanol.
| Compound Name | 1-(3-fluorothiophen-2-yl)-2-(1,3-thiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 130594756 |
| Molecular Formula | C9H8FNOS2 |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | 1-(3-fluorothiophen-2-yl)-2-(1,3-thiazol-5-yl)ethanol |
| SMILES | OC(Cc1cncs1)c1sccc1F |
| InChI | InChI=1S/C9H8FNOS2/c10-7-1-2-13-9(7)8(12)3-6-4-11-5-14-6/h1-2,4-5,8,12H,3H2 |
| InChIKey | PBQAGOFMXLEKIO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |