C12H12FNOS — CID 112642652
1-(3-fluoro-5-methylphenyl)-2-(1,3-thiazol-5-yl)ethanol (PubChem CID 112642652) has the molecular formula C12H12FNOS and a molecular weight of 237.30 g/mol. Its IUPAC name is 1-(3-fluoro-5-methylphenyl)-2-(1,3-thiazol-5-yl)ethanol.
| Compound Name | 1-(3-fluoro-5-methylphenyl)-2-(1,3-thiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 112642652 |
| Molecular Formula | C12H12FNOS |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 1-(3-fluoro-5-methylphenyl)-2-(1,3-thiazol-5-yl)ethanol |
| SMILES | Cc1cc(F)cc(C(O)Cc2cncs2)c1 |
| InChI | InChI=1S/C12H12FNOS/c1-8-2-9(4-10(13)3-8)12(15)5-11-6-14-7-16-11/h2-4,6-7,12,15H,5H2,1H3 |
| InChIKey | KOYYZXHZEIJFIN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |