C12H13NOS — CID 112641878
1-(3-methylphenyl)-2-(1,3-thiazol-5-yl)ethanol (PubChem CID 112641878) has the molecular formula C12H13NOS and a molecular weight of 219.31 g/mol. Its IUPAC name is 1-(3-methylphenyl)-2-(1,3-thiazol-5-yl)ethanol.
| Compound Name | 1-(3-methylphenyl)-2-(1,3-thiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 112641878 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 1-(3-methylphenyl)-2-(1,3-thiazol-5-yl)ethanol |
| SMILES | Cc1cccc(C(O)Cc2cncs2)c1 |
| InChI | InChI=1S/C12H13NOS/c1-9-3-2-4-10(5-9)12(14)6-11-7-13-8-15-11/h2-5,7-8,12,14H,6H2,1H3 |
| InChIKey | GSSGMIMHAPINSI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |