C10H11NO2S — CID 104789529
1-(2-methylfuran-3-yl)-2-(1,3-thiazol-5-yl)ethanol (PubChem CID 104789529) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 1-(2-methylfuran-3-yl)-2-(1,3-thiazol-5-yl)ethanol.
| Compound Name | 1-(2-methylfuran-3-yl)-2-(1,3-thiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 104789529 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 1-(2-methylfuran-3-yl)-2-(1,3-thiazol-5-yl)ethanol |
| SMILES | Cc1occc1C(O)Cc1cncs1 |
| InChI | InChI=1S/C10H11NO2S/c1-7-9(2-3-13-7)10(12)4-8-5-11-6-14-8/h2-3,5-6,10,12H,4H2,1H3 |
| InChIKey | BRZWRMFYRPJALU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |