C15H18O2 — CID 104789418
2-(3,5-dimethylphenyl)-1-(2-methylfuran-3-yl)ethanol (PubChem CID 104789418) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-1-(2-methylfuran-3-yl)ethanol.
| Compound Name | 2-(3,5-dimethylphenyl)-1-(2-methylfuran-3-yl)ethanol |
|---|---|
| PubChem CID | 104789418 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-1-(2-methylfuran-3-yl)ethanol |
| SMILES | Cc1cc(C)cc(CC(O)c2ccoc2C)c1 |
| InChI | InChI=1S/C15H18O2/c1-10-6-11(2)8-13(7-10)9-15(16)14-4-5-17-12(14)3/h4-8,15-16H,9H2,1-3H3 |
| InChIKey | LRLHGQZKAZIXQW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |