C16H16F2O — CID 62802583
1-(2,5-difluorophenyl)-2-(3,5-dimethylphenyl)ethanol (PubChem CID 62802583) has the molecular formula C16H16F2O and a molecular weight of 262.30 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-(3,5-dimethylphenyl)ethanol.
| Compound Name | 1-(2,5-difluorophenyl)-2-(3,5-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 62802583 |
| Molecular Formula | C16H16F2O |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-(3,5-dimethylphenyl)ethanol |
| SMILES | Cc1cc(C)cc(CC(O)c2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C16H16F2O/c1-10-5-11(2)7-12(6-10)8-16(19)14-9-13(17)3-4-15(14)18/h3-7,9,16,19H,8H2,1-2H3 |
| InChIKey | IBDSZUYYFJMYNH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |