C16H17FO — CID 60918138
1-(3,5-dimethylphenyl)-2-(4-fluorophenyl)ethanol (PubChem CID 60918138) has the molecular formula C16H17FO and a molecular weight of 244.31 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-(4-fluorophenyl)ethanol.
| Compound Name | 1-(3,5-dimethylphenyl)-2-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 60918138 |
| Molecular Formula | C16H17FO |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-(4-fluorophenyl)ethanol |
| SMILES | Cc1cc(C)cc(C(O)Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C16H17FO/c1-11-7-12(2)9-14(8-11)16(18)10-13-3-5-15(17)6-4-13/h3-9,16,18H,10H2,1-2H3 |
| InChIKey | GGPRUFKNDCHAKE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |