C15H15FO — CID 7154269
(R)-(3,5-dimethylphenyl)-(4-fluorophenyl)methanol (PubChem CID 7154269) has the molecular formula C15H15FO and a molecular weight of 230.28 g/mol. Its IUPAC name is (R)-(3,5-dimethylphenyl)-(4-fluorophenyl)methanol.
| Compound Name | (R)-(3,5-dimethylphenyl)-(4-fluorophenyl)methanol |
|---|---|
| PubChem CID | 7154269 |
| Molecular Formula | C15H15FO |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | (R)-(3,5-dimethylphenyl)-(4-fluorophenyl)methanol |
| SMILES | Cc1cc(C)cc([C@H](O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C15H15FO/c1-10-7-11(2)9-13(8-10)15(17)12-3-5-14(16)6-4-12/h3-9,15,17H,1-2H3/t15-/m1/s1 |
| InChIKey | JZKVGVUPHRDZIT-OAHLLOKOSA-N |
| XLogP | 3.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |