C16H17FO3 — CID 60797865
1-(3,4-dimethoxyphenyl)-2-(4-fluorophenyl)ethanol (PubChem CID 60797865) has the molecular formula C16H17FO3 and a molecular weight of 276.31 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-(4-fluorophenyl)ethanol.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 60797865 |
| Molecular Formula | C16H17FO3 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-(4-fluorophenyl)ethanol |
| SMILES | COc1ccc(C(O)Cc2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C16H17FO3/c1-19-15-8-5-12(10-16(15)20-2)14(18)9-11-3-6-13(17)7-4-11/h3-8,10,14,18H,9H2,1-2H3 |
| InChIKey | XDTHIVQTXDZTII-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |