C16H16Cl2O3 — CID 61081992
1-(3,4-dichlorophenyl)-2-(3,4-dimethoxyphenyl)ethanol (PubChem CID 61081992) has the molecular formula C16H16Cl2O3 and a molecular weight of 327.21 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-(3,4-dimethoxyphenyl)ethanol.
| Compound Name | 1-(3,4-dichlorophenyl)-2-(3,4-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 61081992 |
| Molecular Formula | C16H16Cl2O3 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-(3,4-dimethoxyphenyl)ethanol |
| SMILES | COc1ccc(CC(O)c2ccc(Cl)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C16H16Cl2O3/c1-20-15-6-3-10(8-16(15)21-2)7-14(19)11-4-5-12(17)13(18)9-11/h3-6,8-9,14,19H,7H2,1-2H3 |
| InChIKey | LNBDPLJCUHPVEF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |